Online Database of Chemicals from Around the World
| CAS No | Product Name | Molecular Formula |
|---|---|---|
| 62338-08-3 | (3E)-3-Ethyl-2,5-Dimethyl-3-Hexene | C10H20 |
| 62338-09-4 | 2,2,3-Trimethyl-Decane | C13H28 |
| 62338-11-8 | 5-Hexyn-1-yl diethylborinate | C10H19BO |
| 62338-12-9 | Trimethyl(4-Methyl-3-Penten-1-Yn-1-Yl)Silane | C9H16Si |
| 62338-16-3 | 3,3,8-Trimethyldecane | C13H28 |
| 62338-24-3 | 1-(4,5-Diethyl-2-Methyl-1-Cyclopenten-1-Yl)Ethanone | C12H20O |
| 62338-25-4 | Methyl Octahydro-4A(2H)-Naphthalenecarboxylate | C12H20O2 |
| 62338-30-1 | 1,1-Dimethyl-2-Octylcyclobutane | C14H28 |
| 62338-40-3 | Decylidenecyclohexane | C16H30 |
| 62338-42-5 | 4,4-Dimethyl-1-[(2E)-2,7-Octadien-1-Yl]Cyclobutene | C14H22 |
| 62338-47-0 | 3-Methyl-4-Decene | C11H22 |
| 62338-52-7 | 3-Hexyl-1,1,2-Trimethylcyclobutane | C13H26 |
| 62338-54-9 | (1Z,5E)-8,8-Dimethyl-9-Methylene-1,5-Cycloundecadiene | C14H22 |
| 62338-55-0 | (1E,5Z)-9-Isopropylidene-1,5-Cycloundecadiene | C14H22 |
| 62338-58-3 | Methyl 5-[(2E)-2-Buten-1-Yl]-2-Cyclohexene-1-Carboxylate | C12H18O2 |
| 62340-37-8 | 4-[2-Hydroxy-3-(propan-2-ylamino)propoxy]phenol | C12H19NO3 |
| 62342-51-2 | Azure II Eosinate | C20H8Br4O5 |
| 62343-98-0 | 1,6-Dichloro-2-Hexanone | C6H10Cl2O |
| 62345-76-0 | 4-[2-(Dimethylamino)Ethoxy]-Benzenamine | C10H16N2O |
| 62346-00-3 | 5-(Acetylamino)-4-Hydroxy-3-[(3-Phosphonophenyl)Azo]Naphthalene-2,7-Disulphonic Acid | C18H16N3O11PS2 |
| 62346-04-7 | 4-Nitrophenyl beta-D-galactopyranoside 3,4,6-triacetate | C18H21NO11 |
| 62346-08-1 | 2-Benzyloxy-4-benzaldehyde beta-D-Glucopyranosiduronic Acid Methyl Ester 2,3,4-Triacetate | C27H28O12 |
| 62346-10-5 | 2-Benzyloxy-4-(2-nitroethenyl)phenyl beta-D-Glucopyranosiduronic Acid Methyl Ester 2,3,4-Triacetate | C28H29NO13 |
| 62346-12-7 | Dopamine 4-O-beta-D-Glucopyranosiduronic Acid Methyl Ester 2,3,4-Triacetate Acetate | C23H31NO13 |
| 62346-20-7 | Buddledin A | C17H24O3 |
| 62346-21-8 | (1R,2R,4E,9S)-2-Hydroxy-4,11,11-Trimethyl-8-Methylenebicyclo[7.2.0]Undec-4-En-3-One | C15H22O2 |
| 62346-22-9 | (1R,4E,9S)-4,11,11-Trimethyl-8-Methylenebicyclo[7.2.0]Undec-4-En-3-One | C15H22O |
| 62346-96-7 | 2,4-Dimethylbenzyl acetate | C11H14O2 |
| 62347-03-9 | [(4,6-Dimethyl-1,3-Phenylene)Bis(Methylene)]Bis[Trimethyl-Silane] | C16H32Si2 |
| 62348-13-4 | 5-Isoxazolecarbonyl chloride | C4H2ClNO2 |
| 62348-20-3 | 1,3-Oxazole-4-Carbonyl Chloride | C4H2ClNO2 |
| 62348-22-5 | 2-Methyl-1,3-Oxazole-4-Carbonyl Chloride | C5H4ClNO2 |
| 62348-24-7 | 4-Methyl-1,3-Oxazole-5-Carbonyl Chloride | C5H4ClNO2 |
| 62351-05-7 | (2,3-Epoxypropyl)[2-(Methacryloyloxy)Ethyl]Dimethylammonium Chloride | C11H20ClNO3 |
| 62351-47-7 | 3,5-Difluorophenylmagnesium bromide | C6H3BrF2Mg |
| 62351-48-8 | 3,5-Difluorobiphenyl | C12H8F2 |
| 62353-75-7 | 3-Methoxy-2-Thiophenecarboxylicacid Methyl Ester | C7H8O3S |
| 62353-80-4 | 1-Hydroxy-2-naphthamide | C11H9NO2 |
| 62353-81-5 | 1-Hydroxy-N-methyl-2-naphthalenecarboxamide | C12H11NO2 |
| 62354-43-2 | D-Valyl-L-leucyl-N-(4-nitrophenyl)-L-lysinamide dihydrochloride | C23H38N6O5.2(HCl) |
| 62354-56-7 | D-Prolyl-L-phenylalanyl-N-(4-nitrophenyl)-L-argininamide dihydrochloride | C26H34N8O5.2(HCl) |
| 62356-27-8 | 2-Bromo-6-chlorotoluene | C7H6BrCl |
| 62356-37-0 | 1-(Ethyl-1-14C)-1H-Pyrrole-2,5-Dione | |
| 62356-47-2 | Isotschimgin | C17H22O3 |
| 62357-86-2 | Desmopressin acetate trihydrate | C46H64N14O12S2.C2H4O2.3(H2O) |
| 62358-12-7 | 20-Dihydroprednisolonic Acid | C21H28O6 |
| 62359-01-7 | N,N-Diisopropylethylamine p-Toluenesulfonate | C15H27NO3S |
| 62359-75-5 | (1R,6R,7S)-2,7-Dimethylbicyclo[4.1.0]Hepta-2,4-Diene-7-Carboxamide | C10H13NO |
| 62360-28-5 | (1R,6R,7S)-2,7-Dimethylbicyclo[4.1.0]Hepta-2,4-Diene-7-Carbonyl Chloride | C10H11ClO |
| 62360-29-6 | 1,3-Dimethyl-2,4,6-Cycloheptatriene-1-Carbonyl Chloride | C10H11ClO |