Online Database of Chemicals from Around the World
| Product Name | CAS Registry Number | Molecular Formula |
|---|---|---|
| Poly(Dibenzo-18-Crown-6) | 53660-42-7 | |
| Poly(2,6-dibromophenol oxide) | 69882-11-7 | (C6H2Br2O)n |
| Poly(2,3-Dibromopropyl methacrylate) | 40715-87-5 | C7H10Br2O2 |
| Poly(2,5-dibutoxy-1,4-phenylene) | 87187-05-1 | (C14H20O2)n |
| Poly(2,6-Dichlorostyrene) | 30350-14-2 | |
| Poly(dicyclopentadiene-co-p-cresol) | 68610-51-5 | |
| Poly(9,9-di-n-dodecylfluorenyl-2,7-diyl) | 248256-53-3 | |
| Poly(diethylene glycol succinate) | 26183-02-8 | C8H13O6 |
| Polydiethylsiloxances | 63148-61-8 | C6H15OSi.(C4H10OSi)n.C6H15Si |
| Poly(9,9-dihexylfluorenyl-2,7-diyl) | 201807-75-2 | (C25H32Br2)n |
| Poly(1,2-dihydro-2,2,4-trimethylquinoline) | 26780-96-1 | (C12H15N)n |
| Poly(alpha,N,N-dimethylamino-epsilon-caprolactam) | 72928-98-4 | |
| POLY(2-DIMETHYLAMINOETHYL METHACRYLATE) | 25154-86-3 | |
| Poly(dimethylaminoethyl methacrylate sulfate) | 64920-28-1 | C8H17NO6S |
| Poly-N,N-Dimethylaminophenylene Methacrylamide N-Oxide | 81527-00-6 | C12H16N2O2 |
| Poly(N,N-Dimethyl-3,5-Dimethylene Piperidinium Chloride) | 113277-70-6 | |
| Poly[(dimethylimino)(2-hydroxy-1,3-propanediyl)chloride] | 39660-17-8 | (C5H12ClNO)n |
| Poly(2-(3',7'-dimethyloctyloxy)-5-methoxy-1,4-phenylene-1-cyanovinylene) | 320725-67-5 | |
| Poly[[2-[(3,7-dimethyloctyl)oxy]-5-methoxy-1,4-phenylene]-1,2-ethenediyl] | 177716-59-5 | (C19H28O2)n |
| Poly(2,6-dimethyl-1,4-phenylene oxide) | 25134-01-4 | [C6H2(CH3)2O]n |
| Poly(1,1-Dimethylsilanamine) | 89535-60-4 | |
| Poly(dimethylsiloxane) | 9016-00-6 | (C2H6OSi)n |
| Polydimethylsiloxane, Carboxydecyldimethyl Terminated | 58130-04-4 | |
| Poly(dimethylsiloxane-co-methylphenylsiloxane) | 63148-52-7 | (C7H8OSi)m.(C2H6OSi)n |
| Poly(Dimethylsiloxane) Distearate Terminated | 130169-63-0 | |
| Poly(dimethylsiloxane)etherimide | 99904-16-2 | |
| Poly(dimethylsiloxane) hydride terminated | 70900-21-9 | |
| Poly(dimethylsiloxane), monoglycidyl ether terminated | 157723-26-7 | |
| Polydimethylsiloxane [(trimethoxysilyl)oxy]-terminated | 142982-20-5 | |
| Poly(dimethylsilylene) | 28883-63-8 | (C2H6Si)n |
| Poly(9,9-dioctylfluorene-co-N-(4-butylphenyl)diphenylamine) | 220797-16-0 | (C51H61N)n |
| Poly(9,9-dioctyl-9H-fluorene-2,7-diyl) | 195456-48-5 | (C29H40)n |
| Poly[(9,9-dioctyl-9H-fluorene-2,7-diyl)-1,2-ethenediyl[[(2-ethylhexyl)oxy]methoxyphenylene]-1,2-ethenediyl] | 475101-36-1 (1383605-56-8) | (C48H66O2)n |
| Poly(9,9-Di-n-Octylfluorenyl-2,7-Diyl) | 19456-48-5 | |
| Poly[(9,9-dioctylfluorenyl-2,7-diyl)-co-(4,4'-(N-(p-butylphenyl))diphenylamine)] | 223569-31-1 | (C51H61N)n |
| Poly(9,9-dioctylfluorenyl-2,7-yleneethynylene) | 278176-17-3 | |
| Poly(2,5-Dioctylphenylene-1,4-Ethynylene) | 336625-87-7 | |
| Poly-4-Dioxan-2-One | 29223-92-5 | C4H6O3 |
| Polydipentene | 9003-73-0 (95327-98-3;6876-12-6) | C10H16 |
| Poly(diphenoxyphosphazene) | 28212-48-8 | (C12H10NO2P)n |
| Poly[p-(2,6-diphenyl)phenylene oxide] | 24938-68-9 | C20H18O |
| Poly(3,4-diphenylthiophene) | 95831-30-4 | (C16H12S)x |
| Poly(dipropyleneglycol)phenyl phosphite | 80584-86-7 | C102H134O31P8 |
| Poly(divinylbenzene-co-methacrylic acid) | 50602-21-6 | |
| Poly(1-Dodecene-Sulfone) | 33990-99-7 | |
| Poly(epsilon-Caprolactone-delta-Valerolactone) | 29612-36-0 | C11H18O4 |
| Poly-epsilon-Cbz-D-Lysine | 57705-97-2 | |
| Poly(N(alpha),N(epsilon)-L-Lysinediylterephthaloyl) | 73706-22-6 | C14H15N2O4 |
| Polyester | 113669-95-7 | |
| Poly(estradiol phosphate) | 9009-22-7 (28014-46-2) | C18H27O6P |