Online Database of Chemicals from Around the World

6-(4-Nitrophenyl)-1,3,5-triazine-2,4-diamine
[CAS 29366-73-2]

List of Suppliers
MolScanner Singapore
www.molscanner.com
+86 18621675448
marketing@molscanner.com
WhatsApp:9896 7603
Chemical manufacturer since 2025
chemBlink Standard supplier since 2025

Identification
ClassificationOrganic raw materials >> Heterocyclic compound >> Triazines
Name6-(4-Nitrophenyl)-1,3,5-triazine-2,4-diamine
Molecular Structure6-(4-Nitrophenyl)-1,3,5-triazine-2,4-diamine molecular structure (CAS 29366-73-2)
Molecular FormulaC9H8N6O2
Molecular Weight232.20
CAS Registry Number29366-73-2
SMILESC1=CC(=CC=C1C2=NC(=NC(=N2)N)N)[N+](=O)[O-]
Safety Data
Hazard Symbolssymbol   GHS07 Warning  Details
Risk StatementsH302-H315-H319-H335  Details
Safety StatementsP261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501  Details
SDSAvailable
up chemBlink Chemical Story
6-(4-Nitrophenyl)-1,3,5-triazine-2,4-diamine is a chemical compound featuring a triazine ring with two amino groups at the 2- and 4-positions and a nitrophenyl group attached to the 6-position. The triazine ring, composed of three nitrogen atoms and three carbon atoms, is a core structure in various bioactive molecules. The nitrophenyl group provides additional functionality, typically contributing to the compound's electronic properties and reactivity.

The discovery of this compound and its analogs is important in the field of medicinal chemistry, where triazine derivatives are often explored for their potential biological activities. Triazine-based compounds have been studied for their ability to interact with various biomolecules, including enzymes, receptors, and other proteins. The presence of the nitrophenyl group is of particular interest because the nitro group is known to have electron-withdrawing properties, which can influence the compound's interaction with biological targets and its overall chemical behavior.

6-(4-Nitrophenyl)-1,3,5-triazine-2,4-diamine is synthesized by introducing the nitrophenyl group at the 6-position of the triazine ring, followed by selective functionalization of the amino groups. The synthetic route typically involves nucleophilic substitution or other reactions that allow the introduction of the nitro group while preserving the integrity of the triazine ring and amino groups. The compound can also be modified further to explore its reactivity and to optimize its properties for various applications.

In terms of applications, this compound may have potential as a lead in drug discovery. The triazine scaffold is frequently employed in the design of biologically active molecules, particularly for their antimicrobial, anticancer, or anti-inflammatory effects. The presence of the nitro group enhances the compound’s ability to interact with specific biological targets, making it a promising candidate for further development.

Additionally, 6-(4-nitrophenyl)-1,3,5-triazine-2,4-diamine could be used in the development of materials or as a precursor in the synthesis of other complex compounds. Triazine derivatives are often employed in the preparation of polymers, dyes, and other specialty chemicals, due to their stability and versatility in various chemical reactions.

Overall, 6-(4-nitrophenyl)-1,3,5-triazine-2,4-diamine is a compound with a wide range of potential applications, especially in medicinal chemistry and materials science. Its structural characteristics, including the triazine ring and nitrophenyl group, make it a valuable building block for the development of new bioactive compounds and advanced materials.

References

1980. Structure-activity study of antiulcerous and antiinflammatory drugs by discriminant analysis. Journal of Medicinal Chemistry, 23(4).
DOI: 10.1021/jm00178a016

2014. A High-Throughput Assay to Identify Inhibitors of the Apicoplast DNA Polymerase from Plasmodium falciparum. Journal of Biomolecular Screening, 19(7).
DOI: 10.1177/1087057114528738

2022. Discovery of small molecule inhibitors of Plasmodium falciparum apicoplast DNA polymerase. Journal of Enzyme Inhibition and Medicinal Chemistry, 37(1).
DOI: 10.1080/14756366.2022.2070909
Market Analysis Reports
Related Products
N-((2-Nitrophen...  4-Nitrophenyl 3...  4-Nitro-N-Pheny...  4-Nitrophenyl t...  p-Nitrophenyl t...  4-Nitrophenyl 2...  2-Nitrophenyl 4...  3-[(2E)-3-(4-Ni...  6-(2-Nitropheny...  6-(3-Nitropheny...  5-(3-Nitropheny...  5-(4-Nitropheny...  5-(2-Nitropheny...  2-(4-Nitropheny...  1-(3-Nitropheny...  1-(4-Nitropheny...  6-Nitro-2-Pheny...  8-Nitro-2-Pheny...  N-(4-Nitropheny...  N-(3-Nitropheny...